C11H11Cl2N3 — CID 43124207
(2,4-dichlorophenyl)-(1-methylpyrazol-4-yl)methanamine (PubChem CID 43124207) has the molecular formula C11H11Cl2N3 and a molecular weight of 256.14 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(1-methylpyrazol-4-yl)methanamine.
| Compound Name | (2,4-dichlorophenyl)-(1-methylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 43124207 |
| Molecular Formula | C11H11Cl2N3 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | (2,4-dichlorophenyl)-(1-methylpyrazol-4-yl)methanamine |
| SMILES | Cn1cc(C(N)c2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C11H11Cl2N3/c1-16-6-7(5-15-16)11(14)9-3-2-8(12)4-10(9)13/h2-6,11H,14H2,1H3 |
| InChIKey | QELGLEVKODLKGB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |