C14H22O2 — CID 105104266
3-(furan-2-yl)-1-(3-methylcyclohexyl)propan-1-ol (PubChem CID 105104266) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-(3-methylcyclohexyl)propan-1-ol.
| Compound Name | 3-(furan-2-yl)-1-(3-methylcyclohexyl)propan-1-ol |
|---|---|
| PubChem CID | 105104266 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 3-(furan-2-yl)-1-(3-methylcyclohexyl)propan-1-ol |
| SMILES | CC1CCCC(C(O)CCc2ccco2)C1 |
| InChI | InChI=1S/C14H22O2/c1-11-4-2-5-12(10-11)14(15)8-7-13-6-3-9-16-13/h3,6,9,11-12,14-15H,2,4-5,7-8,10H2,1H3 |
| InChIKey | HUFCVALLISOLKA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |