C17H20O2 — CID 105131741
1-(2-cyclobutylphenyl)-3-(furan-2-yl)propan-1-ol (PubChem CID 105131741) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-(2-cyclobutylphenyl)-3-(furan-2-yl)propan-1-ol.
| Compound Name | 1-(2-cyclobutylphenyl)-3-(furan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 105131741 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-(2-cyclobutylphenyl)-3-(furan-2-yl)propan-1-ol |
| SMILES | OC(CCc1ccco1)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C17H20O2/c18-17(11-10-14-7-4-12-19-14)16-9-2-1-8-15(16)13-5-3-6-13/h1-2,4,7-9,12-13,17-18H,3,5-6,10-11H2 |
| InChIKey | GOEQGNCMASMOAC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |