C20H24O — CID 105105139
1-(3,5-dimethylcyclohexyl)-2-naphthalen-1-ylethanone (PubChem CID 105105139) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)-2-naphthalen-1-ylethanone.
| Compound Name | 1-(3,5-dimethylcyclohexyl)-2-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 105105139 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)-2-naphthalen-1-ylethanone |
| SMILES | CC1CC(C)CC(C(=O)Cc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C20H24O/c1-14-10-15(2)12-18(11-14)20(21)13-17-8-5-7-16-6-3-4-9-19(16)17/h3-9,14-15,18H,10-13H2,1-2H3 |
| InChIKey | GWJNIUGJEKDNQV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |