C14H21BrN4O — CID 105105696
2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanol (PubChem CID 105105696) has the molecular formula C14H21BrN4O and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanol.
| Compound Name | 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 105105696 |
| Molecular Formula | C14H21BrN4O |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanol |
| SMILES | CCc1cc(C(O)Cc2c(Br)c(CC)nn2C)n(C)n1 |
| InChI | InChI=1S/C14H21BrN4O/c1-5-9-7-11(18(3)16-9)13(20)8-12-14(15)10(6-2)17-19(12)4/h7,13,20H,5-6,8H2,1-4H3 |
| InChIKey | SKIOZLATFYAYPI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |