C14H14Br2F2N2O — CID 107538274
1-(2-bromo-3,4-difluorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanol (PubChem CID 107538274) has the molecular formula C14H14Br2F2N2O and a molecular weight of 424.08 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanol.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 107538274 |
| Molecular Formula | C14H14Br2F2N2O |
| Molecular Weight | 424.08 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanol |
| SMILES | CCc1nn(C)c(CC(O)c2ccc(F)c(F)c2Br)c1Br |
| InChI | InChI=1S/C14H14Br2F2N2O/c1-3-9-13(16)10(20(2)19-9)6-11(21)7-4-5-8(17)14(18)12(7)15/h4-5,11,21H,3,6H2,1-2H3 |
| InChIKey | DYZXQNGVGXZNFC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.08 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|