C13H23F2N — CID 105108346
1-(4,4-difluorocyclohexyl)-N-propylbut-3-en-1-amine (PubChem CID 105108346) has the molecular formula C13H23F2N and a molecular weight of 231.33 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-N-propylbut-3-en-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 105108346 |
| Molecular Formula | C13H23F2N |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-N-propylbut-3-en-1-amine |
| SMILES | C=CCC(NCCC)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H23F2N/c1-3-5-12(16-10-4-2)11-6-8-13(14,15)9-7-11/h3,11-12,16H,1,4-10H2,2H3 |
| InChIKey | MPFDMFQHRGTRKN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|