About 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine
5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine (PubChem CID 123882757) has the molecular formula C12H19F2N
and a molecular weight of 215.29 g/mol. Its IUPAC name is 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine |
| PubChem CID | 123882757 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine |
| SMILES | CC1CC(C2C(F)C=CCC2F)NC1C |
| InChI | InChI=1S/C12H19F2N/c1-7-6-11(15-8(7)2)12-9(13)4-3-5-10(12)14/h3-4,7-12,15H,5-6H2,1-2H3 |
| InChIKey | JQLSOCICTCXLQQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine?
The IUPAC name of 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine (CID 123882757) is 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine.
What is the SMILES notation for 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine?
The canonical SMILES for 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine is CC1CC(C2C(F)C=CCC2F)NC1C.
What is the InChIKey of 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine?
The InChIKey is JQLSOCICTCXLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2N/c1-7-6-11(15-8(7)2)12-9(13)4-3-5-10(12)14/h3-4,7-12,15H,5-6H2,1-2H3.
What are the key properties of 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine?
5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine has a molecular weight of 215.29 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine is sourced from PubChem (CID 123882757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).