C12H19F2N — CID 123882757
5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine (PubChem CID 123882757) has the molecular formula C12H19F2N and a molecular weight of 215.29 g/mol. Its IUPAC name is 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine.
| Compound Name | 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 123882757 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 5-(2,6-difluorocyclohex-3-en-1-yl)-2,3-dimethylpyrrolidine |
| SMILES | CC1CC(C2C(F)C=CCC2F)NC1C |
| InChI | InChI=1S/C12H19F2N/c1-7-6-11(15-8(7)2)12-9(13)4-3-5-10(12)14/h3-4,7-12,15H,5-6H2,1-2H3 |
| InChIKey | JQLSOCICTCXLQQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|