C11H15N3OS — CID 105109200
1-(2-ethyl-1,2,4-triazol-3-yl)-3-thiophen-3-ylpropan-2-ol (PubChem CID 105109200) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)-3-thiophen-3-ylpropan-2-ol.
| Compound Name | 1-(2-ethyl-1,2,4-triazol-3-yl)-3-thiophen-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 105109200 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-(2-ethyl-1,2,4-triazol-3-yl)-3-thiophen-3-ylpropan-2-ol |
| SMILES | CCn1ncnc1CC(O)Cc1ccsc1 |
| InChI | InChI=1S/C11H15N3OS/c1-2-14-11(12-8-13-14)6-10(15)5-9-3-4-16-7-9/h3-4,7-8,10,15H,2,5-6H2,1H3 |
| InChIKey | FOBYFPGACXLPJA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |