C11H13BrN2OS — CID 105127674
1-(4-bromo-1-ethylpyrazol-5-yl)-2-thiophen-3-ylethanol (PubChem CID 105127674) has the molecular formula C11H13BrN2OS and a molecular weight of 301.21 g/mol. Its IUPAC name is 1-(4-bromo-1-ethylpyrazol-5-yl)-2-thiophen-3-ylethanol.
| Compound Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-2-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 105127674 |
| Molecular Formula | C11H13BrN2OS |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-2-thiophen-3-ylethanol |
| SMILES | CCn1ncc(Br)c1C(O)Cc1ccsc1 |
| InChI | InChI=1S/C11H13BrN2OS/c1-2-14-11(9(12)6-13-14)10(15)5-8-3-4-16-7-8/h3-4,6-7,10,15H,2,5H2,1H3 |
| InChIKey | LAKJHGQJDLBBEU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |