C15H20BrN3OS — CID 105110790
2-(3-bromo-4-methoxyphenyl)-1-(4-tert-butylthiadiazol-5-yl)ethanamine (PubChem CID 105110790) has the molecular formula C15H20BrN3OS and a molecular weight of 370.32 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1-(4-tert-butylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1-(4-tert-butylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105110790 |
| Molecular Formula | C15H20BrN3OS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1-(4-tert-butylthiadiazol-5-yl)ethanamine |
| SMILES | COc1ccc(CC(N)c2snnc2C(C)(C)C)cc1Br |
| InChI | InChI=1S/C15H20BrN3OS/c1-15(2,3)14-13(21-19-18-14)11(17)8-9-5-6-12(20-4)10(16)7-9/h5-7,11H,8,17H2,1-4H3 |
| InChIKey | AIBANFYDAMQYCB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |