C9H12N4OS — CID 105112314
2-(1-ethylimidazol-2-yl)-1-(thiadiazol-4-yl)ethanol (PubChem CID 105112314) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 2-(1-ethylimidazol-2-yl)-1-(thiadiazol-4-yl)ethanol.
| Compound Name | 2-(1-ethylimidazol-2-yl)-1-(thiadiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 105112314 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-(1-ethylimidazol-2-yl)-1-(thiadiazol-4-yl)ethanol |
| SMILES | CCn1ccnc1CC(O)c1csnn1 |
| InChI | InChI=1S/C9H12N4OS/c1-2-13-4-3-10-9(13)5-8(14)7-6-15-12-11-7/h3-4,6,8,14H,2,5H2,1H3 |
| InChIKey | QWLCLJHYEBZVHV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |