C10H18O2 — CID 105112647
7-methoxy-2,6-dimethylhept-1-en-4-one (PubChem CID 105112647) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 7-methoxy-2,6-dimethylhept-1-en-4-one.
| Compound Name | 7-methoxy-2,6-dimethylhept-1-en-4-one |
|---|---|
| PubChem CID | 105112647 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 7-methoxy-2,6-dimethylhept-1-en-4-one |
| SMILES | C=C(C)CC(=O)CC(C)COC |
| InChI | InChI=1S/C10H18O2/c1-8(2)5-10(11)6-9(3)7-12-4/h9H,1,5-7H2,2-4H3 |
| InChIKey | OOWDTZWBLILACZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|