C11H18O3 — CID 54115998
1,7-dimethoxy-3,5-dimethylideneheptan-4-one (PubChem CID 54115998) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 1,7-dimethoxy-3,5-dimethylideneheptan-4-one.
| Compound Name | 1,7-dimethoxy-3,5-dimethylideneheptan-4-one |
|---|---|
| PubChem CID | 54115998 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1,7-dimethoxy-3,5-dimethylideneheptan-4-one |
| SMILES | C=C(CCOC)C(=O)C(=C)CCOC |
| InChI | InChI=1S/C11H18O3/c1-9(5-7-13-3)11(12)10(2)6-8-14-4/h1-2,5-8H2,3-4H3 |
| InChIKey | NKJUOVRTRYRJGU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|