C12H17F3N2O2S — CID 105112912
N-methyl-4-methylsulfonyl-1-[5-(trifluoromethyl)-2-pyridinyl]butan-1-amine (PubChem CID 105112912) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is N-methyl-4-methylsulfonyl-1-[5-(trifluoromethyl)-2-pyridinyl]butan-1-amine.
| Compound Name | N-methyl-4-methylsulfonyl-1-[5-(trifluoromethyl)-2-pyridinyl]butan-1-amine |
|---|---|
| PubChem CID | 105112912 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-methyl-4-methylsulfonyl-1-[5-(trifluoromethyl)-2-pyridinyl]butan-1-amine |
| SMILES | CNC(CCCS(C)(=O)=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H17F3N2O2S/c1-16-10(4-3-7-20(2,18)19)11-6-5-9(8-17-11)12(13,14)15/h5-6,8,10,16H,3-4,7H2,1-2H3 |
| InChIKey | APBYVPOPPPJLOP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |