C12H21NO3S — CID 105113102
1-(furan-2-yl)-N-methyl-6-methylsulfonylhexan-3-amine (PubChem CID 105113102) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-(furan-2-yl)-N-methyl-6-methylsulfonylhexan-3-amine.
| Compound Name | 1-(furan-2-yl)-N-methyl-6-methylsulfonylhexan-3-amine |
|---|---|
| PubChem CID | 105113102 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(furan-2-yl)-N-methyl-6-methylsulfonylhexan-3-amine |
| SMILES | CNC(CCCS(C)(=O)=O)CCc1ccco1 |
| InChI | InChI=1S/C12H21NO3S/c1-13-11(5-4-10-17(2,14)15)7-8-12-6-3-9-16-12/h3,6,9,11,13H,4-5,7-8,10H2,1-2H3 |
| InChIKey | CVTVWHJUIPVHPJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |