C14H25NO3S — CID 105152508
N-ethyl-6-ethylsulfonyl-1-(furan-2-yl)hexan-3-amine (PubChem CID 105152508) has the molecular formula C14H25NO3S and a molecular weight of 287.42 g/mol. Its IUPAC name is N-ethyl-6-ethylsulfonyl-1-(furan-2-yl)hexan-3-amine.
| Compound Name | N-ethyl-6-ethylsulfonyl-1-(furan-2-yl)hexan-3-amine |
|---|---|
| PubChem CID | 105152508 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-ethyl-6-ethylsulfonyl-1-(furan-2-yl)hexan-3-amine |
| SMILES | CCNC(CCCS(=O)(=O)CC)CCc1ccco1 |
| InChI | InChI=1S/C14H25NO3S/c1-3-15-13(7-6-12-19(16,17)4-2)9-10-14-8-5-11-18-14/h5,8,11,13,15H,3-4,6-7,9-10,12H2,1-2H3 |
| InChIKey | ZTLPCDFPQPXYNI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |