C9H16O2 — CID 105113110
6-methoxy-2,5-dimethylhex-1-en-3-one (PubChem CID 105113110) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 6-methoxy-2,5-dimethylhex-1-en-3-one.
| Compound Name | 6-methoxy-2,5-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 105113110 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 6-methoxy-2,5-dimethylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)CC(C)COC |
| InChI | InChI=1S/C9H16O2/c1-7(2)9(10)5-8(3)6-11-4/h8H,1,5-6H2,2-4H3 |
| InChIKey | WXOSJUOHULEZLG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|