C11H21F2NO2S — CID 105113392
1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutan-1-amine (PubChem CID 105113392) has the molecular formula C11H21F2NO2S and a molecular weight of 269.36 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutan-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 105113392 |
| Molecular Formula | C11H21F2NO2S |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutan-1-amine |
| SMILES | CS(=O)(=O)CCCC(N)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H21F2NO2S/c1-17(15,16)8-2-3-10(14)9-4-6-11(12,13)7-5-9/h9-10H,2-8,14H2,1H3 |
| InChIKey | XFBLSZWFRAZNDJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |