C14H15BrF4O — CID 105113662
(5-bromo-2-fluorophenyl)-[2-(trifluoromethyl)cyclohexyl]methanol (PubChem CID 105113662) has the molecular formula C14H15BrF4O and a molecular weight of 355.17 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl)-[2-(trifluoromethyl)cyclohexyl]methanol.
| Compound Name | (5-bromo-2-fluorophenyl)-[2-(trifluoromethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 105113662 |
| Molecular Formula | C14H15BrF4O |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | (5-bromo-2-fluorophenyl)-[2-(trifluoromethyl)cyclohexyl]methanol |
| SMILES | OC(c1cc(Br)ccc1F)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H15BrF4O/c15-8-5-6-12(16)10(7-8)13(20)9-3-1-2-4-11(9)14(17,18)19/h5-7,9,11,13,20H,1-4H2 |
| InChIKey | CXQMYJHJPKJKNI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |