C12H14BrFO — CID 107005403
(5-bromo-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methanol (PubChem CID 107005403) has the molecular formula C12H14BrFO and a molecular weight of 273.14 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methanol.
| Compound Name | (5-bromo-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methanol |
|---|---|
| PubChem CID | 107005403 |
| Molecular Formula | C12H14BrFO |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (5-bromo-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methanol |
| SMILES | CC1(C)CC1C(O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C12H14BrFO/c1-12(2)6-9(12)11(15)8-5-7(13)3-4-10(8)14/h3-5,9,11,15H,6H2,1-2H3 |
| InChIKey | KURMHDLOQRABRN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |