2-(2,2,2-trifluoroethoxy)propanoic acid

C5H7F3O3 — CID 10511382

IUPAC2-(2,2,2-trifluoroethoxy)propanoic acid
SMILESCC(OCC(F)(F)F)C(=O)O
InChIInChI=1S/C5H7F3O3/c1-3(4(9)10)11-2-5(6,7)8/h3H,2H2,1H3,(H,9,10)
InChIKeyWLVIHEZFLDLAON-UHFFFAOYSA-N
MW172.10 g/mol
LogP1.04
Rot. Bonds3

About 2-(2,2,2-trifluoroethoxy)propanoic acid

2-(2,2,2-trifluoroethoxy)propanoic acid (PubChem CID 10511382) has the molecular formula C5H7F3O3 and a molecular weight of 172.10 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)propanoic acid.

Molecular Properties

Compound Name2-(2,2,2-trifluoroethoxy)propanoic acid
PubChem CID10511382
Molecular FormulaC5H7F3O3
Molecular Weight172.10 g/mol
Exact Mass172.03
IUPAC Name2-(2,2,2-trifluoroethoxy)propanoic acid
SMILESCC(OCC(F)(F)F)C(=O)O
InChIInChI=1S/C5H7F3O3/c1-3(4(9)10)11-2-5(6,7)8/h3H,2H2,1H3,(H,9,10)
InChIKeyWLVIHEZFLDLAON-UHFFFAOYSA-N
XLogP1.04
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.10
LogP ≤ 51.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,2,2-trifluoroethoxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2,2-trifluoroethoxy)propanoic acid?
The IUPAC name of 2-(2,2,2-trifluoroethoxy)propanoic acid (CID 10511382) is 2-(2,2,2-trifluoroethoxy)propanoic acid.
What is the SMILES notation for 2-(2,2,2-trifluoroethoxy)propanoic acid?
The canonical SMILES for 2-(2,2,2-trifluoroethoxy)propanoic acid is CC(OCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-(2,2,2-trifluoroethoxy)propanoic acid?
The InChIKey is WLVIHEZFLDLAON-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F3O3/c1-3(4(9)10)11-2-5(6,7)8/h3H,2H2,1H3,(H,9,10).
What are the key properties of 2-(2,2,2-trifluoroethoxy)propanoic acid?
2-(2,2,2-trifluoroethoxy)propanoic acid has a molecular weight of 172.10 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethoxy)propanoic acid is sourced from PubChem (CID 10511382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).