C14H18N2O3S — CID 105114504
(3,5-dimethoxyphenyl)-(4-propan-2-ylthiadiazol-5-yl)methanol (PubChem CID 105114504) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(4-propan-2-ylthiadiazol-5-yl)methanol.
| Compound Name | (3,5-dimethoxyphenyl)-(4-propan-2-ylthiadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 105114504 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(4-propan-2-ylthiadiazol-5-yl)methanol |
| SMILES | COc1cc(OC)cc(C(O)c2snnc2C(C)C)c1 |
| InChI | InChI=1S/C14H18N2O3S/c1-8(2)12-14(20-16-15-12)13(17)9-5-10(18-3)7-11(6-9)19-4/h5-8,13,17H,1-4H3 |
| InChIKey | KOUZIAXIDDSKQQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |