C11H16O2 — CID 10511585
[(1S,5S)-3-ethenyl-5-methylcyclohex-2-en-1-yl] acetate (PubChem CID 10511585) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is [(1S,5S)-3-ethenyl-5-methylcyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,5S)-3-ethenyl-5-methylcyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10511585 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | [(1S,5S)-3-ethenyl-5-methylcyclohex-2-en-1-yl] acetate |
| SMILES | C=CC1=C[C@@H](OC(C)=O)C[C@@H](C)C1 |
| InChI | InChI=1S/C11H16O2/c1-4-10-5-8(2)6-11(7-10)13-9(3)12/h4,7-8,11H,1,5-6H2,2-3H3/t8-,11-/m0/s1 |
| InChIKey | FZPOZBOTNMZKGZ-KWQFWETISA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |