C11H18N2O — CID 105117461
1-(1,5-dimethylpyrazol-4-yl)-2-ethylbutan-1-one (PubChem CID 105117461) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-4-yl)-2-ethylbutan-1-one.
| Compound Name | 1-(1,5-dimethylpyrazol-4-yl)-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 105117461 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-4-yl)-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)c1cnn(C)c1C |
| InChI | InChI=1S/C11H18N2O/c1-5-9(6-2)11(14)10-7-12-13(4)8(10)3/h7,9H,5-6H2,1-4H3 |
| InChIKey | ZXDLYIKZAIFEAM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |