C9H15N3O — CID 82408297
4-amino-1-(1,5-dimethylpyrazol-4-yl)butan-1-one (PubChem CID 82408297) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-amino-1-(1,5-dimethylpyrazol-4-yl)butan-1-one.
| Compound Name | 4-amino-1-(1,5-dimethylpyrazol-4-yl)butan-1-one |
|---|---|
| PubChem CID | 82408297 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 4-amino-1-(1,5-dimethylpyrazol-4-yl)butan-1-one |
| SMILES | Cc1c(C(=O)CCCN)cnn1C |
| InChI | InChI=1S/C9H15N3O/c1-7-8(6-11-12(7)2)9(13)4-3-5-10/h6H,3-5,10H2,1-2H3 |
| InChIKey | PFDHJPQDTARHDH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |