C7H5BrN2OS2 — CID 105119290
(3-bromothiophen-2-yl)-(1,2,5-thiadiazol-3-yl)methanol (PubChem CID 105119290) has the molecular formula C7H5BrN2OS2 and a molecular weight of 277.17 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(1,2,5-thiadiazol-3-yl)methanol.
| Compound Name | (3-bromothiophen-2-yl)-(1,2,5-thiadiazol-3-yl)methanol |
|---|---|
| PubChem CID | 105119290 |
| Molecular Formula | C7H5BrN2OS2 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 275.90 |
| IUPAC Name | (3-bromothiophen-2-yl)-(1,2,5-thiadiazol-3-yl)methanol |
| SMILES | OC(c1cnsn1)c1sccc1Br |
| InChI | InChI=1S/C7H5BrN2OS2/c8-4-1-2-12-7(4)6(11)5-3-9-13-10-5/h1-3,6,11H |
| InChIKey | VOGMUBSXUXWBCN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |