C12H18N2O2S — CID 105120395
1-imidazo[2,1-b][1,3]thiazol-6-yl-5-methoxyhexan-2-ol (PubChem CID 105120395) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-imidazo[2,1-b][1,3]thiazol-6-yl-5-methoxyhexan-2-ol.
| Compound Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-5-methoxyhexan-2-ol |
|---|---|
| PubChem CID | 105120395 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-5-methoxyhexan-2-ol |
| SMILES | COC(C)CCC(O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C12H18N2O2S/c1-9(16-2)3-4-11(15)7-10-8-14-5-6-17-12(14)13-10/h5-6,8-9,11,15H,3-4,7H2,1-2H3 |
| InChIKey | JEEKQLYGOJAAGO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |