About (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde
(1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde (PubChem CID 10512153) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde |
| PubChem CID | 10512153 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde |
| SMILES | COCOCC1[C@H](C=O)C=C[C@@H]1C=O |
| InChI | InChI=1S/C10H14O4/c1-13-7-14-6-10-8(4-11)2-3-9(10)5-12/h2-5,8-10H,6-7H2,1H3/t8-,9+,10? |
| InChIKey | LLAOCVYWPXNVGV-ULKQDVFKSA-N |
| XLogP | 0.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde?
The IUPAC name of (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde (CID 10512153) is (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde.
What is the SMILES notation for (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde?
The canonical SMILES for (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde is COCOCC1[C@H](C=O)C=C[C@@H]1C=O.
What is the InChIKey of (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde?
The InChIKey is LLAOCVYWPXNVGV-ULKQDVFKSA-N. The full InChI is InChI=1S/C10H14O4/c1-13-7-14-6-10-8(4-11)2-3-9(10)5-12/h2-5,8-10H,6-7H2,1H3/t8-,9+,10?.
What are the key properties of (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde?
(1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde has a molecular weight of 198.22 g/mol, XLogP of 0.42, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3S)-2-(methoxymethoxymethyl)cyclopent-4-ene-1,3-dicarbaldehyde is sourced from PubChem (CID 10512153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).