C12H20O5 — CID 10728978
(1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-ene-1-carbaldehyde (PubChem CID 10728978) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-ene-1-carbaldehyde.
| Compound Name | (1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 10728978 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-ene-1-carbaldehyde |
| SMILES | COCOC[C@H]1[C@H](C=O)C=C[C@@H]1COCOC |
| InChI | InChI=1S/C12H20O5/c1-14-8-16-6-11-4-3-10(5-13)12(11)7-17-9-15-2/h3-5,10-12H,6-9H2,1-2H3/t10-,11+,12-/m0/s1 |
| InChIKey | RFUGDNQUVZORJV-TUAOUCFPSA-N |
| XLogP | 0.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|