C12H20O6 — CID 10730035
(1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-ene-1-carboxylic acid (PubChem CID 10730035) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-ene-1-carboxylic acid.
| Compound Name | (1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 10730035 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-ene-1-carboxylic acid |
| SMILES | COCOC[C@@H]1[C@@H](COCOC)C=C[C@H]1C(=O)O |
| InChI | InChI=1S/C12H20O6/c1-15-7-17-5-9-3-4-10(12(13)14)11(9)6-18-8-16-2/h3-4,9-11H,5-8H2,1-2H3,(H,13,14)/t9-,10-,11-/m1/s1 |
| InChIKey | MDMVVTMGJHGQED-GMTAPVOTSA-N |
| XLogP | 0.73 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|