C14H22O6 — CID 10517313
[(1S,4R)-4-(acetyloxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate (PubChem CID 10517313) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is [(1S,4R)-4-(acetyloxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate.
| Compound Name | [(1S,4R)-4-(acetyloxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10517313 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(1S,4R)-4-(acetyloxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate |
| SMILES | COCOCC1[C@@H](COC(C)=O)C=C[C@H]1COC(C)=O |
| InChI | InChI=1S/C14H22O6/c1-10(15)19-6-12-4-5-13(7-20-11(2)16)14(12)8-18-9-17-3/h4-5,12-14H,6-9H2,1-3H3/t12-,13+,14? |
| InChIKey | QOFIRDNTIHKMLN-PBWFPOADSA-N |
| XLogP | 1.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|