C14H24O6 — CID 10732086
[(1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate (PubChem CID 10732086) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is [(1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate.
| Compound Name | [(1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10732086 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [(1R,4S,5R)-4,5-bis(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate |
| SMILES | COCOC[C@@H]1[C@@H](COCOC)C=C[C@H]1COC(C)=O |
| InChI | InChI=1S/C14H24O6/c1-11(15)20-7-13-5-4-12(6-18-9-16-2)14(13)8-19-10-17-3/h4-5,12-14H,6-10H2,1-3H3/t12-,13+,14-/m1/s1 |
| InChIKey | DUYAKXWSVYBBPD-HZSPNIEDSA-N |
| XLogP | 1.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|