C12H20O5 — CID 10562251
[(1R,4S,5R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate (PubChem CID 10562251) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(1R,4S,5R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate.
| Compound Name | [(1R,4S,5R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10562251 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [(1R,4S,5R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methyl acetate |
| SMILES | COCOC[C@@H]1[C@@H](CO)C=C[C@H]1COC(C)=O |
| InChI | InChI=1S/C12H20O5/c1-9(14)17-6-11-4-3-10(5-13)12(11)7-16-8-15-2/h3-4,10-13H,5-8H2,1-2H3/t10-,11+,12-/m1/s1 |
| InChIKey | NVVNKSKVGVTVIF-GRYCIOLGSA-N |
| XLogP | 0.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|