C11H16O4 — CID 11310382
2-[(1S,3R,3aR,4R,6aS)-1,3-dimethoxy-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]furan-4-yl]acetaldehyde (PubChem CID 11310382) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 2-[(1S,3R,3aR,4R,6aS)-1,3-dimethoxy-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]furan-4-yl]acetaldehyde.
| Compound Name | 2-[(1S,3R,3aR,4R,6aS)-1,3-dimethoxy-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]furan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11310382 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-[(1S,3R,3aR,4R,6aS)-1,3-dimethoxy-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]furan-4-yl]acetaldehyde |
| SMILES | CO[C@H]1O[C@@H](OC)[C@H]2[C@@H]1C=C[C@H]2CC=O |
| InChI | InChI=1S/C11H16O4/c1-13-10-8-4-3-7(5-6-12)9(8)11(14-2)15-10/h3-4,6-11H,5H2,1-2H3/t7-,8-,9+,10-,11+/m0/s1 |
| InChIKey | NQFCERDXDKWUAI-QUARPLMYSA-N |
| XLogP | 0.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|