C12H22O2 — CID 10512177
trans-(1S,2R)-2-but-3-enyl-2-(hydroxymethyl)cycloheptan-1-ol (PubChem CID 10512177) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is trans-(1S,2R)-2-but-3-enyl-2-(hydroxymethyl)cycloheptan-1-ol.
| Compound Name | trans-(1S,2R)-2-but-3-enyl-2-(hydroxymethyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 10512177 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | trans-(1S,2R)-2-but-3-enyl-2-(hydroxymethyl)cycloheptan-1-ol |
| SMILES | C=CCC[C@@]1(CO)CCCCC[C@@H]1O |
| InChI | InChI=1S/C12H22O2/c1-2-3-8-12(10-13)9-6-4-5-7-11(12)14/h2,11,13-14H,1,3-10H2/t11-,12-/m0/s1 |
| InChIKey | UMMSPJCSFCRFNB-RYUDHWBXSA-N |
| XLogP | 2.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|