C18H24O — CID 105122822
6-methyl-1-naphthalen-1-ylheptan-2-ol (PubChem CID 105122822) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 6-methyl-1-naphthalen-1-ylheptan-2-ol.
| Compound Name | 6-methyl-1-naphthalen-1-ylheptan-2-ol |
|---|---|
| PubChem CID | 105122822 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 6-methyl-1-naphthalen-1-ylheptan-2-ol |
| SMILES | CC(C)CCCC(O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C18H24O/c1-14(2)7-5-11-17(19)13-16-10-6-9-15-8-3-4-12-18(15)16/h3-4,6,8-10,12,14,17,19H,5,7,11,13H2,1-2H3 |
| InChIKey | UEWPMXVHSHSJPJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |