C19H26O2 — CID 83148133
1-(7-methoxynaphthalen-1-yl)-6-methylheptan-2-ol (PubChem CID 83148133) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-(7-methoxynaphthalen-1-yl)-6-methylheptan-2-ol.
| Compound Name | 1-(7-methoxynaphthalen-1-yl)-6-methylheptan-2-ol |
|---|---|
| PubChem CID | 83148133 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-(7-methoxynaphthalen-1-yl)-6-methylheptan-2-ol |
| SMILES | COc1ccc2cccc(CC(O)CCCC(C)C)c2c1 |
| InChI | InChI=1S/C19H26O2/c1-14(2)6-4-9-17(20)12-16-8-5-7-15-10-11-18(21-3)13-19(15)16/h5,7-8,10-11,13-14,17,20H,4,6,9,12H2,1-3H3 |
| InChIKey | BEZQSJWYIDNFDI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |