C19H25NO3 — CID 109380191
N-(2-hydroxy-4-methylpentyl)-2-(7-methoxynaphthalen-1-yl)acetamide (PubChem CID 109380191) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylpentyl)-2-(7-methoxynaphthalen-1-yl)acetamide.
| Compound Name | N-(2-hydroxy-4-methylpentyl)-2-(7-methoxynaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 109380191 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-(2-hydroxy-4-methylpentyl)-2-(7-methoxynaphthalen-1-yl)acetamide |
| SMILES | COc1ccc2cccc(CC(=O)NCC(O)CC(C)C)c2c1 |
| InChI | InChI=1S/C19H25NO3/c1-13(2)9-16(21)12-20-19(22)10-15-6-4-5-14-7-8-17(23-3)11-18(14)15/h4-8,11,13,16,21H,9-10,12H2,1-3H3,(H,20,22) |
| InChIKey | RNFMSCLBYMFMAN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |