C14H21ClN2O3 — CID 111431527
1-(2-chloro-5-methoxyphenyl)-3-(2-hydroxy-4-methylpentyl)urea (PubChem CID 111431527) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is 1-(2-chloro-5-methoxyphenyl)-3-(2-hydroxy-4-methylpentyl)urea.
| Compound Name | 1-(2-chloro-5-methoxyphenyl)-3-(2-hydroxy-4-methylpentyl)urea |
|---|---|
| PubChem CID | 111431527 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-(2-chloro-5-methoxyphenyl)-3-(2-hydroxy-4-methylpentyl)urea |
| SMILES | COc1ccc(Cl)c(NC(=O)NCC(O)CC(C)C)c1 |
| InChI | InChI=1S/C14H21ClN2O3/c1-9(2)6-10(18)8-16-14(19)17-13-7-11(20-3)4-5-12(13)15/h4-5,7,9-10,18H,6,8H2,1-3H3,(H2,16,17,19) |
| InChIKey | JOJWTJXFPSZYAQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |