C20H26N2O3 — CID 75388275
2-[[2-(7-methoxynaphthalen-1-yl)acetyl]amino]-2,4-dimethylpentanamide (PubChem CID 75388275) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[[2-(7-methoxynaphthalen-1-yl)acetyl]amino]-2,4-dimethylpentanamide.
| Compound Name | 2-[[2-(7-methoxynaphthalen-1-yl)acetyl]amino]-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 75388275 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[[2-(7-methoxynaphthalen-1-yl)acetyl]amino]-2,4-dimethylpentanamide |
| SMILES | COc1ccc2cccc(CC(=O)NC(C)(CC(C)C)C(N)=O)c2c1 |
| InChI | InChI=1S/C20H26N2O3/c1-13(2)12-20(3,19(21)24)22-18(23)10-15-7-5-6-14-8-9-16(25-4)11-17(14)15/h5-9,11,13H,10,12H2,1-4H3,(H2,21,24)(H,22,23) |
| InChIKey | ZWHVNIJZEYNZPQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |