C18H23NO2 — CID 19696840
3-(7-methoxynaphthalen-1-yl)-N-(2-methylpropyl)propanamide (PubChem CID 19696840) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(7-methoxynaphthalen-1-yl)-N-(2-methylpropyl)propanamide.
| Compound Name | 3-(7-methoxynaphthalen-1-yl)-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 19696840 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-(7-methoxynaphthalen-1-yl)-N-(2-methylpropyl)propanamide |
| SMILES | COc1ccc2cccc(CCC(=O)NCC(C)C)c2c1 |
| InChI | InChI=1S/C18H23NO2/c1-13(2)12-19-18(20)10-8-15-6-4-5-14-7-9-16(21-3)11-17(14)15/h4-7,9,11,13H,8,10,12H2,1-3H3,(H,19,20) |
| InChIKey | LLCAIZDRONSEMH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |