C19H23NO5 — CID 120532234
4-methoxy-3-[[2-(7-methoxynaphthalen-1-yl)acetyl]amino]-3-methylbutanoic acid (PubChem CID 120532234) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-methoxy-3-[[2-(7-methoxynaphthalen-1-yl)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 4-methoxy-3-[[2-(7-methoxynaphthalen-1-yl)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 120532234 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 4-methoxy-3-[[2-(7-methoxynaphthalen-1-yl)acetyl]amino]-3-methylbutanoic acid |
| SMILES | COCC(C)(CC(=O)O)NC(=O)Cc1cccc2ccc(OC)cc12 |
| InChI | InChI=1S/C19H23NO5/c1-19(12-24-2,11-18(22)23)20-17(21)9-14-6-4-5-13-7-8-15(25-3)10-16(13)14/h4-8,10H,9,11-12H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | WBAMEJVDZHJUNH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |