C19H22N4O2 — CID 75388312
2-(7-methoxynaphthalen-1-yl)-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propyl]acetamide (PubChem CID 75388312) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(7-methoxynaphthalen-1-yl)-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propyl]acetamide.
| Compound Name | 2-(7-methoxynaphthalen-1-yl)-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propyl]acetamide |
|---|---|
| PubChem CID | 75388312 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-(7-methoxynaphthalen-1-yl)-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propyl]acetamide |
| SMILES | COc1ccc2cccc(CC(=O)NCCCc3n[nH]c(C)n3)c2c1 |
| InChI | InChI=1S/C19H22N4O2/c1-13-21-18(23-22-13)7-4-10-20-19(24)11-15-6-3-5-14-8-9-16(25-2)12-17(14)15/h3,5-6,8-9,12H,4,7,10-11H2,1-2H3,(H,20,24)(H,21,22,23) |
| InChIKey | WXVGXYKNZMLRGZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|