C12H16N2O2 — CID 105122915
1-(2-ethyl-5-methylpyrazol-3-yl)-2-(furan-2-yl)ethanol (PubChem CID 105122915) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(2-ethyl-5-methylpyrazol-3-yl)-2-(furan-2-yl)ethanol.
| Compound Name | 1-(2-ethyl-5-methylpyrazol-3-yl)-2-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 105122915 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-(2-ethyl-5-methylpyrazol-3-yl)-2-(furan-2-yl)ethanol |
| SMILES | CCn1nc(C)cc1C(O)Cc1ccco1 |
| InChI | InChI=1S/C12H16N2O2/c1-3-14-11(7-9(2)13-14)12(15)8-10-5-4-6-16-10/h4-7,12,15H,3,8H2,1-2H3 |
| InChIKey | FZSALYYAGQWRSF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |