C11H14N2O2 — CID 105122958
1-(2,5-dimethylpyrazol-3-yl)-2-(furan-2-yl)ethanol (PubChem CID 105122958) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-2-(furan-2-yl)ethanol.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-2-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 105122958 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-2-(furan-2-yl)ethanol |
| SMILES | Cc1cc(C(O)Cc2ccco2)n(C)n1 |
| InChI | InChI=1S/C11H14N2O2/c1-8-6-10(13(2)12-8)11(14)7-9-4-3-5-15-9/h3-6,11,14H,7H2,1-2H3 |
| InChIKey | OWFLPPGIRHZKBB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |