C11H15F2NOS — CID 105123267
1-(4,4-difluorocyclohexyl)-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 105123267) has the molecular formula C11H15F2NOS and a molecular weight of 247.31 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 105123267 |
| Molecular Formula | C11H15F2NOS |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | OC(Cc1cncs1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H15F2NOS/c12-11(13)3-1-8(2-4-11)10(15)5-9-6-14-7-16-9/h6-8,10,15H,1-5H2 |
| InChIKey | FRPKXWWYJUYZST-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |