C15H21ClO3 — CID 105123648
1-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-4-propoxybutan-2-ol (PubChem CID 105123648) has the molecular formula C15H21ClO3 and a molecular weight of 284.78 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-4-propoxybutan-2-ol.
| Compound Name | 1-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-4-propoxybutan-2-ol |
|---|---|
| PubChem CID | 105123648 |
| Molecular Formula | C15H21ClO3 |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-4-propoxybutan-2-ol |
| SMILES | CCCOCCC(O)Cc1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C15H21ClO3/c1-2-5-18-6-4-14(17)10-12-9-13(16)8-11-3-7-19-15(11)12/h8-9,14,17H,2-7,10H2,1H3 |
| InChIKey | XMKALDNOPVGAIT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|