C7H13N3S — CID 105125486
1-(1,2,5-thiadiazol-3-yl)pentan-1-amine (PubChem CID 105125486) has the molecular formula C7H13N3S and a molecular weight of 171.27 g/mol. Its IUPAC name is 1-(1,2,5-thiadiazol-3-yl)pentan-1-amine.
| Compound Name | 1-(1,2,5-thiadiazol-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 105125486 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-(1,2,5-thiadiazol-3-yl)pentan-1-amine |
| SMILES | CCCCC(N)c1cnsn1 |
| InChI | InChI=1S/C7H13N3S/c1-2-3-4-6(8)7-5-9-11-10-7/h5-6H,2-4,8H2,1H3 |
| InChIKey | HPJXMWMCYPOYRB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |