C17H30N2 — CID 105126732
N,N-dimethyl-3-[4-methyl-1-(propylamino)pentyl]aniline (PubChem CID 105126732) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-methyl-1-(propylamino)pentyl]aniline.
| Compound Name | N,N-dimethyl-3-[4-methyl-1-(propylamino)pentyl]aniline |
|---|---|
| PubChem CID | 105126732 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N,N-dimethyl-3-[4-methyl-1-(propylamino)pentyl]aniline |
| SMILES | CCCNC(CCC(C)C)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C17H30N2/c1-6-12-18-17(11-10-14(2)3)15-8-7-9-16(13-15)19(4)5/h7-9,13-14,17-18H,6,10-12H2,1-5H3 |
| InChIKey | RRTNXXSLCYGBAR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |